You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1987100 |
---|---|
Category | Small Molecules |
Description | Colistin A is an antibiotic generated by certain strains of the bacteria Paenibacillus polymyxa. Colistin is a mixture of the cyclic polypeptides colistin A and B and belongs to the class of polypeptide antibiotics known as polymyxins. Colistin is effective against most Gram-negative bacilli. |
Purity | 98.00% |
MW | 1169.46 |
Biological Activity | Colistin A is an antibiotic generated by certain strains of the bacteria Paenibacillus polymyxa. Colistin is a mixture of the cyclic polypeptides colistin A and B and belongs to the class of polypeptide antibiotics known as polymyxins. Colistin is effective against most Gram-negative bacilli. |
CAS Number | 7722-44-3 |
Formula | C53H100N16O13 |
SMILES | N(C([C@@H](NC([C@@H](NC([C@@H](NC(CCCC[C@H](CC)C)=O)CCN)=O)[C@@H](C)O)=O)CCN)=O)[C@@H]1C(=O)N[C@@H](CCN)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCN)C(=O)N[C@@H](CCN)C(=O)N[C@@]([C@@H](C)O)(C(=O)NCC1)[H] |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
8068-28-8 | |
1749.8 | |
C58H105N16Na5O28S5 |