You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2802423 |
---|---|
Category | Small Molecules |
Description | Ceftolozane TFA is a cephalosporin class antibiotic (antibiotic) designed to inhibit Gram-negative bacterial infections. Additionally, it can be utilized in the synthesis of novel antibiotics (antibiotic) that are more efficacious and safer. |
MW | 780.71 |
CAS Number | 1628046-32-1 |
Formula | C25H31F3N12O10S2 |
SMILES | C(C([O-])=O)(F)(F)F.C(O)(=O)C=1N2[C@@]([C@H](NC(/C(=N\OC(C(O)=O)(C)C)/C3=NSC(N)=N3)=O)C2=O)(SCC1C[N+]4=CC(NC(NCCN)=O)=C(N)N4C)[H] |
Storage | -20°C |
Note | For research use only |