You have no items in your shopping cart.
Cart summary
Alisol B 23-acetate
Catalog Number: orb1300161
| Catalog Number | orb1300161 |
|---|---|
| Category | Small Molecules |
| Description | Alisol B 23-acetate |
| CAS Number | 26575-95-1 |
| Purity | 99.87% |
| MW | 514.74 |
| SMILES | C[C@H](C[C@H](OC(C)=O)[C@H]1OC1(C)C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1 |
| Formula | C32H50O5 |
| Biological Activity | 1. Alisol B 23-acetate (Alisol B Acetate) produces protective effect against ANIT-induced hepatotoxity and cholestasis, due to FXR-mediated regulation of transporters and enzymes. 2. Alisol B 23-acetate produces promotive effect on liver regeneration, due to FXR-mediated regulation of genes involved in hepatocyte proliferation and hepato-protection. 3. Alisol B 23-acetate produces a protective effect against CCl4-induced hepatotoxicity, due to FXR and STAT3-mediated gene regulation. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
