You have no items in your shopping cart.
Cart summary
7-Aminocephalosporanic acid
Catalog Number: orb1310098
| Catalog Number | orb1310098 |
|---|---|
| Category | Small Molecules |
| Description | 7-Aminocephalosporanic acid |
| Purity | 91.05% |
| MW | 272.28 |
| Biological Activity | 7-Aminocephalosporanic acid is an HSP90β inhibitor used in the synthesis of cephalosporin antibiotics and their intermediates. |
| CAS Number | [957-68-6] |
| Formula | C10H12N2O5S |
| SMILES | C(O)(=O)C=1N2[C@@]([C@H](N)C2=O)(SCC1COC(C)=O)[H] |
| Storage | -20°C |
| Note | For research use only |
7-Aminocephalosporanic acid [orb1223520]
> 98%(HPLC)
957-68-6
272.3
C10H12N2O5S
1 g, 500 mg, 200 mg, 100 mg, 50 mg
