You have no items in your shopping cart.
Cart summary
7-Amino-4-methylcoumarin-3-acetic acid
Catalog Number: orb1297479
| Catalog Number | orb1297479 |
|---|---|
| Category | Small Molecules |
| Description | 7-Amino-4-methylcoumarin-3-acetic acid |
| CAS Number | 106562-32-7 |
| Purity | 96.68% |
| MW | 233.22 |
| SMILES | Cc1c(CC(O)=O)c(=O)oc2cc(N)ccc12 |
| Formula | C12H11NO4 |
| Biological Activity | 7-Amino-4-methylcoumarin-3-acetic acid (7-Amino-4-methylcoumarin) is more suitable as a substrate for enteropeptidase than GD(4)K-NA. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
