You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1680150 |
---|---|
Category | Small Molecules |
Description | Cyanidin-3-O-(6''-malonylglucoside) chloride |
CAS Number | 171828-62-9 |
Purity | 98% |
MW | 535.43 |
SMILES | O(C=1C(=[O+]C2=C(C1)C(O)=CC(O)=C2)C3=CC(O)=C(O)C=C3)[C@@H]4O[C@H](COC(CC(O)=O)=O)[C@@H](O)[C@H](O)[C@H]4O |
Formula | C24H23O14 |
Biological Activity | Cyanidin-3-O-(6''-malonylglucoside) chloride is a natural product for research related to life sciences. The catalog number is orb1680150 and the CAS number is 171828-62-9. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
FC, IF, IHC-Fr, IHC-P, WB | |
Bovine, Drosophila, Porcine, Rabbit | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, IF, IHC-Fr, IHC-P, WB | |
Bovine, Canine, Porcine | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IF, IHC-Fr, IHC-P, WB | |
Mouse, Rat | |
Human, Mouse, Rat | |
Mouse | |
Monoclonal | |
Unconjugated |
ELISA, ICC, IF, IHC-P, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |