You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611791 |
---|---|
Category | Small Molecules |
Description | G10 (STING Agonist 1) is a novel human-specific STING agonist. |
CAS Number | [702662-50-8] |
MW | 430.8797 |
SMILES | ClC1=C([H])C([H])=C([H])C(=C1C([H])([H])N1C(C([H])([H])SC2C([H])=C([H])C(C(N([H])C([H])([H])C3=C([H])C([H])=C([H])O3)=O)=C([H])C1=2)=O)F |
Formula | C21H16CLFN2O3S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.72% | |
2138498-18-5 | |
849.94 | |
C42H51N13O7 |
98.29% | |
2138299-33-7 | |
849.94 | |
C42H51N13O7 |
99.55% | |
2138299-34-8 | |
959.32 | |
C42H54Cl3N13O7 |
98.76% | |
702662-50-8 | |
430.88 | |
C21H16ClFN2O3S |