You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1821676 |
---|---|
Category | Small Molecules |
Description | Indirect activator of STING signaling |
CAS Number | 702662-50-8 |
Purity | ≥98% |
MW | 430.88 |
SMILES | C1C(=O)N(C2=C(S1)C=CC(=C2)C(=O)NCC3=CC=CO3)CC4=C(C=CC=C4Cl)F |
Storage | Storage Temp: -20°C |
Alternative names | G10 Read more... |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.72% | |
2138498-18-5 | |
849.94 | |
C42H51N13O7 |
98.29% | |
2138299-33-7 | |
849.94 | |
C42H51N13O7 |
99.55% | |
2138299-34-8 | |
959.32 | |
C42H54Cl3N13O7 |
98.76% | |
702662-50-8 | |
430.88 | |
C21H16ClFN2O3S |