You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2565445 |
---|---|
Category | Small Molecules |
Description | PPARγ agonist 10 (compound 33g) serves as a PPARγ agonist, enhancing insulin secretion, glucose uptake, and insulin sensitivity in βTC6 cells [1]. |
Purity | 98.00% |
MW | 386.45 |
CAS Number | 2445990-92-9 |
Formula | C17H14N4O3S2 |
SMILES | C(=C\1/C(=O)N(CC(O)=O)C(=S)S1)\C=2C=NC(NCC3=CC=CC=C3)=NC2 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
1000998-59-3 | |
444.9 | |
C22H21ClN2O6 |
98.00% | |
2123485-34-5 | |
387.564 | |
C24H37NO3 |
98.00% | |
1233715-28-0 | |
342.479 | |
C22H30O3 |