You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1692476 |
---|---|
Category | Small Molecules |
Description | Glucocorticoid receptor agonist-1 |
Purity | 99.51% |
MW | 569.69 |
Biological Activity | Glucocorticoid receptor agonist-1 is a potent glucocorticoid receptor agonist with an IC50 of 2.8 nM[1]. |
CAS Number | 2166375-82-0 |
Formula | C35H39NO6 |
SMILES | [H][C@]1(O[C@]2([H])C[C@@]3([H])[C@]4([H])CCC5=CC(=O)C=C[C@]5(C)[C@@]4([H])[C@@H](O)C[C@]3(C)[C@@]2(O1)C(=O)CO)c1ccc(Cc2cccc(N)c2)cc1 |
Storage | -20°C |
Note | For research use only |
98.00% | |
2734877-83-7 | |
949.86 | |
C44H51F3N3O15P |
98.00% | |
2344809-82-9 | |
956.77 | |
C44H51BrN3O14P |
98.00% | |
2345732-83-2 | |
915.87 | |
C46H50N3O15P |