You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1785980 |
---|---|
Category | Small Molecules |
Description | BIOTIN-11-DCTP is a fluorescent dye for DNA labeling. |
MW | 861.688428401947 |
CAS Number | [136632-30-9] |
Formula | C28H46N7O16P3S |
SMILES | C(OP(=O)(O)OP(O)(=O)OP(O)(O)=O)[C@H]1O[C@@H](N2C=C(/C=C/CNC(=O)CCCCCNC(=O)CCCC[C@H]3[C@@]4([H])NC(=O)N[C@@]4([H])CS3)C(N)=NC2=O)C[C@@H]1O |
Note | For research use only |
≥ 95% (HPLC) | |
136632-30-9 | |
Theoretical MW: 859.67 g/mol (free acid); Detected MW: 859.18 g/mol (free acid) | |
C28H44N7O16P3S |
≥ 95% (HPLC) | |
136632-30-9 | |
Theoretical MW: 859.67 g/mol (free acid); Detected MW: 859.18 g/mol (free acid) | |
C28H44N7O16P3S |