You have no items in your shopping cart.
Cart summary
Afegostat
Catalog Number: orb1706270
| Catalog Number | orb1706270 |
|---|---|
| Category | Small Molecules |
| Description | Afegostat is a pharmacological chaperone that specifically and reversibly binds acid-β-glucosidase (GCase) in the endoplasmic reticulum with high affinity. |
| Purity | 98.00% |
| MW | 147.17 |
| Biological Activity | Afegostat is a pharmacological chaperone that specifically and reversibly binds acid-β-glucosidase (GCase) in the endoplasmic reticulum with high affinity. |
| CAS Number | 169105-89-9 |
| Formula | C6H13NO3 |
| SMILES | C(O)[C@@H]1[C@@H](O)[C@H](O)CNC1 |
| Storage | -20°C |
| Note | For research use only |
