You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb746471 |
---|---|
Category | Small Molecules |
Description | A potent, selective and, cell and in vivo active p300/CBP catalytic inhibitor with IC50 of 9.8/2.6 nM. |
CAS Number | [1889279-16-6] |
MW | 536.484 |
SMILES | C(N(CC1=CC=C(F)C=C1)[C@H](C)C(F)(F)F)(=O)CN1C(=O)[C@](OC1=O)1C2=C(C=C(NC(NC)=O)C=C2)CC1 |
Formula | C25H24F4N4O5 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
IHC-P, IP, WB | |
Human, Mouse, Rat | |
Mouse | |
Monoclonal | |
Unconjugated |
IHC-P, WB | |
Human | |
Rabbit | |
Recombinant | |
Unconjugated |
IHC-P, WB | |
Human | |
Rabbit | |
Recombinant | |
Unconjugated |
IHC-P, IP, WB | |
Human, Mouse, Rat | |
Mouse | |
Monoclonal | |
Unconjugated |
IHC-P, WB | |
Human | |
Mouse | |
Monoclonal | |
Unconjugated |