You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1989707 |
---|---|
Category | Small Molecules |
Description | Vitexin arginine is a natural c-glycosylated flavone isolated from various medicinal plants species,with anti-oxidant, anti-cancer, anti-inflammatory, anti-hyperalgesic, and neuroprotective effects. |
Purity | 98.00% |
MW | 606.58 |
Biological Activity | Vitexin arginine is a natural c-glycosylated flavone isolated from various medicinal plants species,with anti-oxidant, anti-cancer, anti-inflammatory, anti-hyperalgesic, and neuroprotective effects. |
Formula | C27H34N4O12 |
SMILES | O[C@@H]([C@H](O)[C@H]1O)[C@@H](CO)O[C@H]1C2=C3C(C(C=C(C4=CC=C(O)C=C4)O3)=O)=C(O)C=C2O.N/C(N)=N\CCC[C@H](N)C(O)=O |
Storage | -20°C |
Note | For research use only |