You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2563719 |
---|---|
Category | Small Molecules |
Description | Serpinin, an agonist of the protease inhibitor Nexin-1 (PN-1), upregulates PN-1 expression via the cAMP-PKA-Sp1 signaling pathway, facilitating granule biogenesis in endocrine cells. It is employed in research on secretory function regulation [1]. Serpinin selectively targets β-adrenergic receptors, particularly interacting with β1-adrenergic receptors to activate the AC-cAMP-PKA pathway, thereby regulating myocardial systolic and diastolic function. Additionally, pGlu-serpinin upregulates Bcl2 mRNA transcription and provides neuroprotective effects [2]. |
Purity | 98.00% |
MW | 2891.14 |
CAS Number | 1383743-23-4 |
Formula | C125H204N32O46 |
SMILES | [C@H](CC1=CN=CN1)(C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC(C)C)C(O)=O)=O)C)=O)CCC(N)=O)=O)CC(C)C)=O)CCC(N)=O)=O)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(=O)[C@@H]2CCCN2)CCC(O)=O)=O)CC(O)=O)=O)CCC(N)=O)=O)CCC(O)=O)=O)CC(C)C)=O)CCC(O)=O)=O)CO)=O)CC(C)C)=O)CO)=O)C)=O)[C@H](CC)C)=O)CCC(O)=O)=O)C)=O)CCC(O)=O)=O)CC(C)C)=O)CCC(O)=O)=O)CCCCN)=O)C(C)C)=O)C)=O |
Storage | -20°C |
Note | For research use only |
IHC, IP, WB | |
Human, Mouse, Rat | |
Rabbit | |
Monoclonal | |
Unconjugated |
FC, ICC, IF, IHC, WB | |
Human | |
Rabbit | |
Monoclonal | |
Unconjugated |
WB | |
Human | |
Rabbit | |
Monoclonal | |
Unconjugated |
> 90% as determined by SDS-PAGE. | |
50.33 kDa |