You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1304143 |
---|---|
Category | Small Molecules |
Description | Remodelin |
Purity | 99.78% |
MW | 282.36 |
Biological Activity | Remodelin is an effective and specific inhibitor of the acetyl-transferase protein NAT10. |
CAS Number | [949912-58-7] |
Formula | C15H14N4S |
SMILES | Br.N#Cc1ccc(cc1)-c1csc(NN=C2CCCC2)n1 |
Storage | -20°C |
Note | For research use only |
98.00% | |
[1622921-15-6] | |
363.28 | |
C15H15BrN4S |