You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1089595 |
---|---|
Category | Small Molecules |
Description | Pimethixene or Calmixen is antihistamine and anticholinergic of the thioxanthene chemical class that is often used to treat hyperactivity, anxiety, sleep disorders, and allergy. |
CAS Number | [314-03-4] |
MW | 293.426 |
SMILES | CN1CC/C(CC1)=C2C3=C(SC4=C\2C=CC=C4)C=CC=C3 |
Formula | C19H19NS |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.10% | |
314-03-4 | |
293.43 | |
C19H19NS |
98% | |
13187-06-9 | |
409.5 | |
C23H23NO4S |