You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb654771 |
---|---|
Category | Small Molecules |
Description | MLN4924 is a small molecule inhibitor of Nedd8 activating enzyme (NAE) with IC50 of 4 nM. |
CAS Number | [905579-51-3] |
MW | 443.52 |
SMILES | O=S(OC[C@@H]1C[C@@H](N2C3=NC=NC(N[C@H]4CCC5=C4C=CC=C5)=C3C=C2)C[C@@H]1O)(N)=O |
Formula | C21H25N5O4S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.63% | |
905579-51-3 | |
443.52 | |
C21H25N5O4S |
99.31% | |
1160295-21-5 | |
479.98 | |
C21H26ClN5O4S |