You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2653235 |
---|---|
Category | Small Molecules |
Description | Patulin (Terinin) is a mycotoxin produced by fungi including the Aspergillus, Penicillium, and Byssochlamys species, causes chromosome breakage, mutation, teratogenic and cytotoxic. Patulin induces autophagy-dependent apoptosis through lysosomal-mitochondrial axis, and causes DNA damage. |
CAS Number | [149-29-1] |
MW | 154.1201 |
SMILES | O1C([H])([H])C([H])=C2C(=C([H])C(=O)O2)C1([H])O[H] |
Formula | C7H6O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.91% | |
149-29-1 | |
154.12 | |
C7H6O4 |