You have no items in your shopping cart.
Cart summary
Nurr1 agonist 8
Catalog Number: orb1943133
| Catalog Number | orb1943133 |
|---|---|
| Category | Small Molecules |
| Description | Nurr1 agonist 8 is a low-affinity Nurr1 agonist that can be used to study neurological diseases such as Parkinson's. |
| Purity | 99.69% |
| MW | 297.13 |
| Biological Activity | Nurr1 agonist 8 is a low-affinity Nurr1 agonist that can be used to study neurological diseases such as Parkinson's. |
| CAS Number | [360778-55-8] |
| Formula | C14H10Cl2O3 |
| SMILES | OC(=O)C1=CC(OCC2=C(Cl)C=C(Cl)C=C2)=CC=C1 |
| Storage | -20°C |
| Note | For research use only |
