You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1943024 |
---|---|
Category | Small Molecules |
Description | Multiflorin A, an active compound extracted from Pruni semen, exhibits laxative properties and hinders intestinal glucose absorption while facilitating bacterial metabolism [1]. |
CAS Number | [1350028-90-8] |
Purity | 98.00% |
MW | 636.55 |
SMILES | O=C1C=2C(OC(=C1O[C@H]3[C@H](O)[C@H](O)[C@@H](O[C@@H]4O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]4O)[C@H](C)O3)C5=CC=C(O)C=C5)=CC(O)=CC2O |
Formula | C29H32O16 |
Biological Activity | Multiflorin A, an active compound extracted from Pruni semen, exhibits laxative properties and hinders intestinal glucose absorption while facilitating bacterial metabolism [1]. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |