You have no items in your shopping cart.
Cart summary
Monopotassium glutamate
Catalog Number: orb1306676
| Catalog Number | orb1306676 |
|---|---|
| Category | Small Molecules |
| Description | Monopotassium glutamate |
| CAS Number | 19473-49-5 |
| Purity | 98% |
| MW | 185.22 |
| SMILES | N[C@@H](CCC(O)=O)C([O-])=O.[K+] |
| Formula | C5H8KNO4 |
| Biological Activity | Monopotassium glutamate (Potassium glutamate) can be used in foods as a flavor enhancer. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
