You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300180 |
---|---|
Category | Small Molecules |
Description | Linderane |
Purity | 98.25% |
MW | 260.29 |
Biological Activity | 1. Linderane was characterized as a mechanism-based inactivator of CYP2C9. |
CAS Number | [13476-25-0] |
Formula | C15H16O4 |
SMILES | Cc1coc2C\C(C)=C/CC[C@]34O[C@@H]3[C@@H](OC4=O)c12 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
13476-25-0 | |
260.3 | |
C15H16O4 |