You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1089573 |
---|---|
Category | Small Molecules |
Description | KEA1-97 (KEA 1-97) is a small molecule that disrupts the interaction of thioredoxin with caspase 3. |
CAS Number | [2138882-71-8] |
MW | 335.163 |
SMILES | N1=C(Cl)N=C(Cl)N=C1NC1=CC=C(C2=CC=C(F)C=C2)C=C1 |
Formula | C15H9Cl2FN4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.70% | |
2138882-71-8 | |
335.16 | |
C15H9Cl2FN4 |