You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1984270 |
---|---|
Category | Small Molecules |
Description | Isosalvianolic acid B is a natural from Salviae miltiorrhizae |
Purity | 98.00% |
MW | 718.61 |
Biological Activity | Isosalvianolic acid B is a natural from Salviae miltiorrhizae |
CAS Number | 930573-88-9 |
Formula | C36H30O16 |
SMILES | C(OC(CC1=CC(O)=C(O)C=C1)C(O)=O)(=O)C2C=3C(OC2C4=CC(O)=C(O)C=C4)=C(O)C=CC3/C=C/C(OC(CC5=CC(O)=C(O)C=C5)C(O)=O)=O |
Storage | -20°C |
Note | For research use only |