You have no items in your shopping cart.
Cart summary
TLR7/8 agonist 7
Catalog Number: orb1744741
| Catalog Number | orb1744741 |
|---|---|
| Category | Small Molecules |
| Description | TLR7/8 agonist 7, a compound that functions as a TLR7/8 agonist, plays a pivotal role in activating various immune cells and is instrumental in the synthesis of immune-stimulating antibody conjugate (ISAC) molecules. This compound holds significant potential for research in immunology. |
| Purity | 98.00% |
| MW | 479.62 |
| Biological Activity | TLR7/8 agonist 7, a compound that functions as a TLR7/8 agonist, plays a pivotal role in activating various immune cells and is instrumental in the synthesis of immune-stimulating antibody conjugate (ISAC) molecules. This compound holds significant potential for research in immunology. |
| CAS Number | 2567953-47-1 |
| Formula | C26H37N7O2 |
| SMILES | C(N1CC2(C1)CNCCO2)C3=CC(OC)=C(CN4C=5C(C=C4)=NC(N)=NC5NCCCCC)C=C3 |
| Storage | -20°C |
| Note | For research use only |
