You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1309685 |
---|---|
Category | Small Molecules |
Description | Shikonin |
Purity | 98.54% |
MW | 288.3 |
Biological Activity | Shikonin (Anchusa acid) is a natural product, a TMEM16A chloride channel inhibitor (IC50=6.5 μM) and selective PKM2 inhibitor. Shikonin exhibits antitumor, anti-inflammatory and wound healing activities. |
CAS Number | [517-89-5] |
Formula | C16H16O5 |
SMILES | CC(C)=CC[C@@H](O)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
517-88-4 | |
288.3 | |
C16H16O5 |
> 98% (HPLC) | |
24502-78-1 | |
330.3 | |
C18H18O6 |
> 98% (HPLC) | |
517-89-5 | |
288.3 | |
C16H16O5 |
98.54% | |
[54952-43-1] | |
288.3 | |
C16H16O5 |