You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1942430 |
---|---|
Category | Small Molecules |
Description | Ganoderic acid T, a natural compound isolated from Ganoderma lucidum [1], exhibits various pharmacological properties. |
Purity | 98.00% |
MW | 612.79 |
Biological Activity | Ganoderic acid T, a natural compound isolated from Ganoderma lucidum [1], exhibits various pharmacological properties. |
CAS Number | 103992-91-2 |
Formula | C36H52O8 |
SMILES | C[C@]12C=3C([C@]4(C)[C@@](CC3)(C(C)(C)[C@H](OC(C)=O)CC4)[H])=CC[C@]1(C)[C@@]([C@@H]([C@H](C/C=C(/C(O)=O)\C)OC(C)=O)C)(C[C@@H]2OC(C)=O)[H] |
Storage | -20°C |
Note | For research use only |