You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1685380 |
---|---|
Category | Small Molecules |
Description | GALNON |
Purity | 98.00% |
MW | 678.82 |
Biological Activity | Galnon is a galanin receptor agonist, improves intrinsic cortical bone tissue properties |
CAS Number | [475115-35-6] |
Formula | C40H46N4O6 |
SMILES | C(OC(N[C@@H](CC1CCCCC1)C(N[C@H](C(NC=2C=C3C(=CC2)C(C)=CC(=O)O3)=O)CCCCN)=O)=O)C4C=5C(C=6C4=CC=CC6)=CC=CC5 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
475115-35-6 | |
678.8 | |
C40H46N4O6 |
> 98% (HPLC) | |
—— | |
92.8 | |
C42H47F3N4O8 |
99.92% | |
1217448-19-5 | |
792.84 | |
C42H47F3N4O8 |