You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611380 |
---|---|
Category | Small Molecules |
Description | Fluorescein isothiocyanate(FITC) is a derivative of fluorescein used in wide-ranging applications including flow cytometry. |
CAS Number | [3326-32-7] |
MW | 389.3807 |
SMILES | O=C1C2C=C(N=C=S)C=CC=2C2(C3=CC=C(O)C=C3OC3C=C(O)C=CC2=3)O1 |
Formula | C21H11NO5S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
FC, IF, IHC | |
Rabbit | |
Goat | |
Polyclonal | |
FITC |
FC | |
Human | |
Mouse | |
Monoclonal | |
FITC/PE |