You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2277230 |
---|---|
Category | Small Molecules |
Description | Drosocin, a 19-mer cationic antimicrobial peptide from Drosophila melanogaster, displays biological activity. Native drosocin features a disaccharide moiety linked to a mid-chain threonine residue, whereas the synthetic variant, which maintains the identical amino acid sequence but lacks the disaccharide, exhibits significantly reduced activity compared to the natural form. |
Purity | 98.00% |
MW | 2198.53 |
Biological Activity | Drosocin, a 19-mer cationic antimicrobial peptide from Drosophila melanogaster, displays biological activity. Native drosocin features a disaccharide moiety linked to a mid-chain threonine residue, whereas the synthetic variant, which maintains the identical amino acid sequence but lacks the disaccharide, exhibits significantly reduced activity compared to the natural form. |
CAS Number | 149924-99-2 |
Formula | C98H160N34O24 |
SMILES | C([C@H](CC1=CN=CN1)NC([C@@H](NC([C@@H](NC(=O)[C@H]2N(C([C@@H](NC(=O)[C@H]3N(C([C@@H](NC([C@@H](NC(=O)[C@H]4N(C([C@@H](NC(=O)[C@H]5N(C([C@H](CCCCN)NC(CN)=O)=O)CCC5)CCCNC(=N)N)=O)CCC4)CC6=CC=C(O)C=C6)=O)CO)=O)CCC3)CCCNC(=N)N)=O)CCC2)[C@@H](C)O)=O)CO)=O)(=O)N7[C@H](C(N[C@H](C(=O)N8[C@H](C(N[C@H](C(N[C@H](C(N[C@@H]([C@H](C)C)C(O)=O)=O)CCCNC(=N)N)=O)[C@H](CC)C)=O)CCC8)CCCNC(=N)N)=O)CCC7 |
Storage | -20°C |
Note | For research use only |