You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1679065 |
---|---|
Category | Small Molecules |
Description | Dofequidar |
CAS Number | 129716-58-1 |
Purity | 98% |
MW | 481.59 |
SMILES | O=C(N1CCN(CC1)CC(O)COC2=CC=CC3=NC=CC=C32)C(C=4C=CC=CC4)C=5C=CC=CC5 |
Formula | C30H31N3O3 |
Biological Activity | Dofequidar (MS-209) is a quinoline compound that can reverse P-glycoprotein (P-gp)-mediated MDR. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.43% | |
153653-30-6 | |
597.66 | |
C34H35N3O7 |