You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb422372 |
---|---|
Category | Small Molecules |
Description | DNQX is a elective non-NMDA antagonist |
CAS Number | [2379-57-9] |
MW | 252.1406 |
SMILES | O=C1C(N([H])C2=C([H])C(=C(C([H])=C2N1[H])[N+](=O)[O-])[N+](=O)[O-])=O |
Formula | C8H4N4O6 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
100% | |
1312992-24-7 | |
296.1 | |
C8H2N4Na2O6 |
[1312992-24-7] | |
296.1 | |
C8H2N4Na2O6 |