You have no items in your shopping cart.
Cart summary
Diisononyl phthalate
Catalog Number: orb692140
| Catalog Number | orb692140 |
|---|---|
| Category | Small Molecules |
| Description | Diisononyl phthalate (DINP) is a phthalate used as a plasticizer. DINP is typically a mixture of chemical compounds consisting of various isononyl esters of phthalic acid. |
| CAS Number | [28553-12-0] |
| MW | 418.61 |
| SMILES | O=C(C1=CC=CC=C1C(OCCCCCCC(C)C)=O)OCCCCCCC(C)C |
| Formula | C26H42O4 |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
