You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1986117 |
---|---|
Category | Small Molecules |
Description | Diisononyl phthalate (DINP), known as a plasticizer, is a phthalate. DINP is specifically a mixture of various isononyl esters of phthalic acid. |
CAS Number | 28553-12-0 |
Purity | 98.00% |
MW | 418.61 |
SMILES | CC(C)CCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCC(C)C |
Formula | C26H42O4 |
Biological Activity | Diisononyl phthalate (DINP), known as a plasticizer, is a phthalate. DINP is specifically a mixture of various isononyl esters of phthalic acid. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |