You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb104960 |
---|---|
Category | Small Molecules |
Description | cucurbitacin E |
CAS Number | [18444-66-1] |
Purity | > 98%,Standard References |
MW | 556.69 |
SMILES | C[C@@]([C@@]1([H])[C@]2(C)[C@@](C=C3O)([H])C(C(C)(C)C3=O)=CC1)(C[C@H]4O)[C@@](CC2=O)(C)[C@@]4([H])[C@@](C)(O)C(/C=C/C(C)(C)OC(C)=O)=O |
Formula | C32H44O8 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of cucurbitacin E
99.19% | |
18444-66-1 | |
556.69 | |
C32H44O8 |
99.35% | |
1398-78-3 | |
718.83 | |
C38H54O13 |