You have no items in your shopping cart.
Cart summary
Cortisone acetate
Catalog Number: orb1310999
| Catalog Number | orb1310999 |
|---|---|
| Category | Small Molecules |
| Description | Cortisone acetate |
| Purity | 98.34% |
| MW | 402.48 |
| Biological Activity | Cortisone Acetate is a synthetic or semisynthetic analog of the naturally occurring cortisone hormone produced by the adrenal glands with anti-inflammatory and immunomodulating properties. Cortisone acetate (NSC-49420) diffuses through the cell membrane and binds to nuclear glucocorticoid receptors. The receptor-ligand complex binds to promotor regions of certain genes and initiates RNA transcription. This results in an induction of synthesis of certain anti-inflammatory proteins while inhibiting the synthesis of certain inflammatory mediators. |
| CAS Number | [50-04-4] |
| Formula | C23H30O6 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(C)=O)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| Storage | -20°C |
| Note | For research use only |
