You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1982869 |
---|---|
Category | Small Molecules |
Description | CI-39, a natural antiviral product, serves as a non-nucleoside reverse transcriptase inhibitor (NNRTI) targeting wild type HIV-1. It exhibits an effective concentration (EC50) of 3.40 µM against the virus, while its cytotoxic concentration (CC50) exceeds 30 µM. This compound notably impedes HIV-1 reverse transcriptase (RT) DNA polymerase and ribonuclease H activities[1]. |
Purity | 98.00% |
MW | 338.36 |
Biological Activity | CI-39, a natural antiviral product, serves as a non-nucleoside reverse transcriptase inhibitor (NNRTI) targeting wild type HIV-1. It exhibits an effective concentration (EC50) of 3.40 µM against the virus, while its cytotoxic concentration (CC50) exceeds 30 µM. This compound notably impedes HIV-1 reverse transcriptase (RT) DNA polymerase and ribonuclease H activities[1]. |
CAS Number | 2132412-25-8 |
Formula | C19H18N2O4 |
SMILES | COC(=O)c1ccccc1NC(=O)Cc1cn(OC)c2ccccc12 |
Storage | -20°C |
Note | For research use only |