You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1308564 |
---|---|
Category | Small Molecules |
Description | Biotin NHS |
Purity | 98.63% |
MW | 341.38 |
Biological Activity | Biotin NHS (NHS-Biotin) is an amino reactive biotin reagent used to prepare biotinylated surfaces or polypeptides. |
CAS Number | [35013-72-0] |
Formula | C14H19N3O5S |
SMILES | O=C(CCCCC1SCC2NC(=O)NC12)ON1C(=O)CCC1=O |
Storage | -20°C |
Note | For research use only |
≥ 95% (HPLC) | |
116840-18-7 | |
Theoretical MW: 523.22 g/mol (free acid); Detected MW: 523.02 g/mol (free acid) | |
C12H20N3O14P3 |
IF, IHC-Fr, IHC-P | |
Bovine, Canine, Equine, Gallus, Human, Porcine, Rabbit, Sheep | |
Mouse, Rat | |
Rabbit | |
Polyclonal | |
Biotin |
≥ 93% (HPLC) | |
115899-39-3 | |
Theoretical MW: 520.22 g/mol (free acid); Detected MW: 520.02 g/mol (free acid) | |
C12H19N4O13P3 |
≥ 93% (HPLC) | |
115899-39-3 | |
Theoretical MW: 520.22 g/mol (free acid); Detected MW: 520.02 g/mol (free acid) | |
C12H19N4O13P3 |
≥ 93% (HPLC) | |
115899-39-3 | |
Theoretical MW: 520.22 g/mol (free acid); Detected MW: 520.02 g/mol (free acid) | |
C12H19N4O13P3 |