You have no items in your shopping cart.
Cart summary
Benzethonium chloride
Catalog Number: orb1310647
| Catalog Number | orb1310647 |
|---|---|
| Category | Small Molecules |
| Description | Benzethonium chloride |
| Purity | 99.91% |
| MW | 448.09 |
| Biological Activity | Benzethonium chloride (Quatrachlor) is a synthetic quaternary ammonium salt with surfactant, antiseptic, and broad spectrum antimicrobial properties. |
| CAS Number | [121-54-0] |
| Formula | C27H42ClNO2 |
| SMILES | [Cl-].CC(C)(C)CC(C)(C)C1=CC=C(OCCOCC[N+](C)(C)CC2=CC=CC=C2)C=C1 |
| Storage | -20°C |
| Note | For research use only |
Benzethonium chloride [orb1226778]
> 98%(HPLC)
121-54-0
448.1
C27H42ClNO2
500 mg, 50 mg, 100 mg, 200 mg, 1 g
