You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1089862 |
---|---|
Category | Small Molecules |
Description | A nontoxic heat shock protein (HSP) coinducer and potentiator of the heat shock response. |
CAS Number | [289893-25-0] |
MW | 313.7799 |
SMILES | Cl/C(C1=C[N+]([O-])=CC=C1)=N\OC[C@H](O)CN2CCCCC2 |
Formula | C14H20N3O3CL |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.81% | |
289893-25-0 | |
313.78 | |
C14H20ClN3O3 |
99.90% | |
289893-26-1 | |
429.85 | |
C18H24ClN3O7 |