You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2653135 |
---|---|
Category | Small Molecules |
Description | Adrenochrome is a chemical compound produced by the oxidation of adrenaline (epinephrine). The derivative carbazochrome is a hemostatic medication. |
CAS Number | [54-06-8] |
MW | 179.17266 |
SMILES | CN1CC(C2=CC(=O)C(=O)C=C21)O |
Formula | C9H9NO3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.00% | |
4009-68-1 | |
331.35 | |
C11H17N5O5S |