You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1705829 |
---|---|
Category | Small Molecules |
Description | Adrenochrome |
CAS Number | 54-06-8 |
Purity | 98% |
MW | 179.18 |
SMILES | OC1C=2C(N(C)C1)=CC(=O)C(=O)C2 |
Formula | C9H9NO3 |
Biological Activity | Adrenochrome is a chemical compound produced by the oxidation of adrenaline. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.00% | |
4009-68-1 | |
331.35 | |
C11H17N5O5S |