You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611844 |
---|---|
Category | Small Molecules |
Description | A highly potent sigma receptor agonist with Ki of 1.7 nM and 25.2 nM for σ1 and σ2, respectively. |
CAS Number | [155798-08-6] |
MW | 420.2873 |
SMILES | C(N1CCC(NC(=O)C2C=CC(I)=CC=2)CC1)C1C=CC=CC=1 |
Formula | C19H21IN2O |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
IF, IH, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, WB | |
Porcine | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IHC-P, WB | |
Bovine, Porcine | |
Human, Mouse | |
Rabbit | |
Polyclonal | |
Unconjugated |
IHC-P, WB | |
Porcine, Sheep | |
Human, Mouse | |
Rabbit | |
Polyclonal | |
Unconjugated |