You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1984260 |
---|---|
Category | Small Molecules |
Description | 2,3-Dihydro-3-methoxywithaferin A is a natural withanolide that exhibits cytotoxicity to human cancer cells and serves as a potential anticancer compound. Additionally, it protects normal cells against stress. |
Purity | 98.00% |
MW | 502.648 |
Biological Activity | 2,3-Dihydro-3-methoxywithaferin A is a natural withanolide , is cytotoxic to human cancer cells, and is a candidate anticancer natural compound. It protects normal cells against stress. |
CAS Number | 21902-96-5 |
Formula | C29H42O7 |
SMILES | [H][C@@]12C[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)[C@@]5([H])CC(C)=C(CO)C(=O)O5)[C@@]4(C)CC[C@]3([H])[C@@]3(C)C(=O)CC(OC)[C@H](O)[C@@]13O2 |t:17| |
Storage | -20°C |
Note | For research use only |