You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb105257 |
---|---|
Category | Small Molecules |
Description | Uridine |
CAS Number | [58-96-8] |
Purity | > 98%,Standard References |
MW | 244.2 |
SMILES | O[C@H]([C@@H]1O)[C@@H](O[C@@H]1CO)N(C=CC2=O)C(N2)=O |
Formula | C9H12N2O6 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
IF, IHC-Fr, IHC-P, WB | |
Bovine, Canine, Equine, Porcine, Rabbit, Sheep | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
ICC, IF, IHC-Fr, IHC-P, WB | |
Rat | |
Human, Mouse | |
Rabbit | |
Recombinant | |
Unconjugated |
Rabbit | |
Polyclonal | |
Unconjugated |
Rabbit | |
Polyclonal | |
Biotin |
Rabbit | |
Polyclonal | |
Biotin |