You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2283481 |
---|---|
Category | Small Molecules |
Description | UDP-GalNAz disodium (UDP-N-azidoacetylgalactosamine disodium) serves as an analogue to UDP-GalNAc, the substrate for various N-acetylgalactosaminyltransferases that catalyze the transfer of GalNAc onto saccharide or peptide acceptors. As a click chemistry tool, UDP-GalNAz features an azide group enabling it to partake in copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with alkyne-bearing molecules. Additionally, it can engage in strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. |
Purity | 98.00% |
MW | 692.33 |
Biological Activity | UDP-GalNAz disodium (UDP-N-azidoacetylgalactosamine disodium) serves as an analogue to UDP-GalNAc, the substrate for various N-acetylgalactosaminyltransferases that catalyze the transfer of GalNAc onto saccharide or peptide acceptors. As a click chemistry tool, UDP-GalNAz features an azide group enabling it to partake in copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with alkyne-bearing molecules. Additionally, it can engage in strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. |
CAS Number | 653600-61-4 |
Formula | C17H24N6Na2O17P2 |
SMILES | O[C@H]1[C@@H](O[C@H](COP(OP(O[C@@H]2[C@H](NC(CN=[N+]=[N-])=O)[C@@H](O)[C@@H](O)[C@@H](CO)O2)(=O)O)(=O)O)[C@H]1O)N3C(=O)NC(=O)C=C3.[Na] |
Storage | -20°C |
Note | For research use only |