You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb341781 |
---|---|
Category | Small Molecules |
Description | TIC10 inactivates Akt and ERK to induce TRAIL through Foxo3a, possesses superior drug properties: delivery across the blood-brain barrier, superior stability and improved pharmacokinetics |
CAS Number | [1616632-77-9] |
MW | 386.499 |
SMILES | O=C1C2C([H])([H])N(C([H])([H])C3C([H])=C([H])C([H])=C([H])C=3[H])C([H])([H])C([H])([H])C=2N2C([H])([H])C([H])([H])N=C2N1C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1C([H])([H])[H] |
Formula | C24H26N4O |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.72% | |
1616632-77-9 | |
386.49 | |
C24H26N4O |
99.25% | |
41276-02-2 | |
386.49 | |
C24H26N4O |