You have no items in your shopping cart.
Cart summary
Tempol (4-Hydroxy-TEMPO)
Catalog Number: orb134423
| Catalog Number | orb134423 |
|---|---|
| Category | Small Molecules |
| Description | TEMPOL (4-Hydroxy-TEMPO) is a superoxide scavenger that displays neuroprotective, anti-inflammatory and analgesic effects. |
| CAS Number | [2226-96-2] |
| MW | 172.24 |
| SMILES | CC1(C)N([O])C(C)(C)CC(O)C1 |
| Formula | C9H18NO2 |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
