You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb746515 |
---|---|
Category | Small Molecules |
Description | TCH-165 is a specific small molecule modulator of proteasome assembly, regulates the dynamic equilibrium between the 20S and 26S proteasome complexes, favoring 20S-mediated protein degradation. |
CAS Number | [1446350-60-2] |
MW | 595.743 |
SMILES | C(C1=CC=C(OC)C=C1)1N(CC2=CC=CC=C2)[C@@H](C2=CC=C(NCC3=CC=CC=C3)C=C2)[C@@](C2=CC=CC=C2)(C(OCC)=O)N=1 |
Formula | C39H37N3O3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.48% | |
1446350-60-2 | |
595.73 | |
C39H37N3O3 |